C21H40N2O3 — CID 143890152
N-cyclohexyl-2-hydroxy-N-[1-(3-methylcyclobutyl)piperidin-4-yl]acetamide;methoxyethane (PubChem CID 143890152) has the molecular formula C21H40N2O3 and a molecular weight of 368.56 g/mol. Its IUPAC name is N-cyclohexyl-2-hydroxy-N-[1-(3-methylcyclobutyl)piperidin-4-yl]acetamide;methoxyethane.
| Compound Name | N-cyclohexyl-2-hydroxy-N-[1-(3-methylcyclobutyl)piperidin-4-yl]acetamide;methoxyethane |
|---|---|
| PubChem CID | 143890152 |
| Molecular Formula | C21H40N2O3 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.30 |
| IUPAC Name | N-cyclohexyl-2-hydroxy-N-[1-(3-methylcyclobutyl)piperidin-4-yl]acetamide;methoxyethane |
| SMILES | CC1CC(N2CCC(N(C(=O)CO)C3CCCCC3)CC2)C1.CCOC |
| InChI | InChI=1S/C18H32N2O2.C3H8O/c1-14-11-17(12-14)19-9-7-16(8-10-19)20(18(22)13-21)15-5-3-2-4-6-15;1-3-4-2/h14-17,21H,2-13H2,1H3;3H2,1-2H3 |
| InChIKey | YOKOAZMTPPZYEI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |