C11H20N2 — CID 143891060
1-N'-(4-methylpent-1-yn-3-yl)-1-N-propylethene-1,1-diamine (PubChem CID 143891060) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 1-N'-(4-methylpent-1-yn-3-yl)-1-N-propylethene-1,1-diamine.
| Compound Name | 1-N'-(4-methylpent-1-yn-3-yl)-1-N-propylethene-1,1-diamine |
|---|---|
| PubChem CID | 143891060 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1-N'-(4-methylpent-1-yn-3-yl)-1-N-propylethene-1,1-diamine |
| SMILES | C#CC(NC(=C)NCCC)C(C)C |
| InChI | InChI=1S/C11H20N2/c1-6-8-12-10(5)13-11(7-2)9(3)4/h2,9,11-13H,5-6,8H2,1,3-4H3 |
| InChIKey | HNWCRLGZSNZZNW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|