C25H42N4O8S — CID 143894097
tert-butyl N-[(2S)-3-[(Z)-7-amino-6-methylhept-4-enoxy]-1-[2-[2-(cyclopropylsulfonylamino)-2-oxoacetyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]carbamate (PubChem CID 143894097) has the molecular formula C25H42N4O8S and a molecular weight of 558.70 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-[(Z)-7-amino-6-methylhept-4-enoxy]-1-[2-[2-(cyclopropylsulfonylamino)-2-oxoacetyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-[(Z)-7-amino-6-methylhept-4-enoxy]-1-[2-[2-(cyclopropylsulfonylamino)-2-oxoacetyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 143894097 |
| Molecular Formula | C25H42N4O8S |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | tert-butyl N-[(2S)-3-[(Z)-7-amino-6-methylhept-4-enoxy]-1-[2-[2-(cyclopropylsulfonylamino)-2-oxoacetyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(/C=C\CCCOC[C@H](NC(=O)OC(C)(C)C)C(=O)N1CCCC1C(=O)C(=O)NS(=O)(=O)C1CC1)CN |
| InChI | InChI=1S/C25H42N4O8S/c1-17(15-26)9-6-5-7-14-36-16-19(27-24(33)37-25(2,3)4)23(32)29-13-8-10-20(29)21(30)22(31)28-38(34,35)18-11-12-18/h6,9,17-20H,5,7-8,10-16,26H2,1-4H3,(H,27,33)(H,28,31)/b9-6-/t17?,19-,20?/m0/s1 |
| InChIKey | HOUYAOGKLJCKMJ-LRJDAPIRSA-N |
| XLogP | 1.00 |
| TPSA | 174.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|