C47H44N2O — CID 143898123
2,3-dimethylbut-2-ene;3-[3-[3-[3-(5-methoxycyclohexa-1,5-dien-1-yl)phenyl]-5-(3-pyridin-3-ylphenyl)phenyl]phenyl]pyridine (PubChem CID 143898123) has the molecular formula C47H44N2O and a molecular weight of 652.88 g/mol. Its IUPAC name is 2,3-dimethylbut-2-ene;3-[3-[3-[3-(5-methoxycyclohexa-1,5-dien-1-yl)phenyl]-5-(3-pyridin-3-ylphenyl)phenyl]phenyl]pyridine.
| Compound Name | 2,3-dimethylbut-2-ene;3-[3-[3-[3-(5-methoxycyclohexa-1,5-dien-1-yl)phenyl]-5-(3-pyridin-3-ylphenyl)phenyl]phenyl]pyridine |
|---|---|
| PubChem CID | 143898123 |
| Molecular Formula | C47H44N2O |
| Molecular Weight | 652.88 g/mol |
| Exact Mass | 652.35 |
| IUPAC Name | 2,3-dimethylbut-2-ene;3-[3-[3-[3-(5-methoxycyclohexa-1,5-dien-1-yl)phenyl]-5-(3-pyridin-3-ylphenyl)phenyl]phenyl]pyridine |
| SMILES | CC(C)=C(C)C.COC1=CC(c2cccc(-c3cc(-c4cccc(-c5cccnc5)c4)cc(-c4cccc(-c5cccnc5)c4)c3)c2)=CCC1 |
| InChI | InChI=1S/C41H32N2O.C6H12/c1-44-41-17-5-14-35(26-41)29-8-2-11-32(20-29)38-23-39(33-12-3-9-30(21-33)36-15-6-18-42-27-36)25-40(24-38)34-13-4-10-31(22-34)37-16-7-19-43-28-37;1-5(2)6(3)4/h2-4,6-16,18-28H,5,17H2,1H3;1-4H3 |
| InChIKey | UFPFWBKYFXVEOJ-UHFFFAOYSA-N |
| XLogP | 12.88 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.88 |
| LogP ≤ 5 | 12.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|