C12H19FO — CID 143901353
(7E)-8-fluoro-5-methyl-6-methylidenedeca-7,9-dien-2-ol (PubChem CID 143901353) has the molecular formula C12H19FO and a molecular weight of 198.28 g/mol. Its IUPAC name is (7E)-8-fluoro-5-methyl-6-methylidenedeca-7,9-dien-2-ol.
| Compound Name | (7E)-8-fluoro-5-methyl-6-methylidenedeca-7,9-dien-2-ol |
|---|---|
| PubChem CID | 143901353 |
| Molecular Formula | C12H19FO |
| Molecular Weight | 198.28 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (7E)-8-fluoro-5-methyl-6-methylidenedeca-7,9-dien-2-ol |
| SMILES | C=C/C(F)=C\C(=C)C(C)CCC(C)O |
| InChI | InChI=1S/C12H19FO/c1-5-12(13)8-10(3)9(2)6-7-11(4)14/h5,8-9,11,14H,1,3,6-7H2,2,4H3/b12-8+ |
| InChIKey | AMNBZYUQCNFPTR-XYOKQWHBSA-N |
| XLogP | 3.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|