C39H42O11 — CID 143904320
(2R,4S)-2-(3,4-dimethoxyphenyl)-4-[(2S)-2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-3-methyl-3,4-dihydro-2H-chromen-8-yl]-5,7-dimethoxy-4H-chromen-3-one (PubChem CID 143904320) has the molecular formula C39H42O11 and a molecular weight of 686.75 g/mol. Its IUPAC name is (2R,4S)-2-(3,4-dimethoxyphenyl)-4-[(2S)-2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-3-methyl-3,4-dihydro-2H-chromen-8-yl]-5,7-dimethoxy-4H-chromen-3-one.
| Compound Name | (2R,4S)-2-(3,4-dimethoxyphenyl)-4-[(2S)-2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-3-methyl-3,4-dihydro-2H-chromen-8-yl]-5,7-dimethoxy-4H-chromen-3-one |
|---|---|
| PubChem CID | 143904320 |
| Molecular Formula | C39H42O11 |
| Molecular Weight | 686.75 g/mol |
| Exact Mass | 686.27 |
| IUPAC Name | (2R,4S)-2-(3,4-dimethoxyphenyl)-4-[(2S)-2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-3-methyl-3,4-dihydro-2H-chromen-8-yl]-5,7-dimethoxy-4H-chromen-3-one |
| SMILES | COc1cc(OC)c2c(c1)O[C@H](c1ccc(OC)c(OC)c1)C(=O)[C@@H]2c1c(OC)cc(OC)c2c1O[C@H](c1ccc(OC)c(OC)c1)C(C)C2 |
| InChI | InChI=1S/C39H42O11/c1-20-14-24-27(44-5)19-31(48-9)34(39(24)50-37(20)21-10-12-25(42-3)28(15-21)45-6)35-33-30(47-8)17-23(41-2)18-32(33)49-38(36(35)40)22-11-13-26(43-4)29(16-22)46-7/h10-13,15-20,35,37-38H,14H2,1-9H3/t20?,35-,37-,38+/m0/s1 |
| InChIKey | UBZNFCCQZPFPOD-IDGAJRTCSA-N |
| XLogP | 6.90 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.75 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |