C22H30O7 — CID 143904324
5,7-dimethoxy-4-methyl-4H-chromen-3-one;3,5-dimethoxyphenol;ethane (PubChem CID 143904324) has the molecular formula C22H30O7 and a molecular weight of 406.48 g/mol. Its IUPAC name is 5,7-dimethoxy-4-methyl-4H-chromen-3-one;3,5-dimethoxyphenol;ethane.
| Compound Name | 5,7-dimethoxy-4-methyl-4H-chromen-3-one;3,5-dimethoxyphenol;ethane |
|---|---|
| PubChem CID | 143904324 |
| Molecular Formula | C22H30O7 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 5,7-dimethoxy-4-methyl-4H-chromen-3-one;3,5-dimethoxyphenol;ethane |
| SMILES | CC.COc1cc(O)cc(OC)c1.COc1cc(OC)c2c(c1)OCC(=O)C2C |
| InChI | InChI=1S/C12H14O4.C8H10O3.C2H6/c1-7-9(13)6-16-11-5-8(14-2)4-10(15-3)12(7)11;1-10-7-3-6(9)4-8(5-7)11-2;1-2/h4-5,7H,6H2,1-3H3;3-5,9H,1-2H3;1-2H3 |
| InChIKey | WFXZSKUVJCFJSF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |