C29H33N7O2 — CID 143913303
2-[ethyl(propyl)amino]-N-[2-[3-[(6-ethynylquinazolin-2-yl)amino]-5-(1-methylpyrazol-4-yl)phenoxy]ethyl]acetamide (PubChem CID 143913303) has the molecular formula C29H33N7O2 and a molecular weight of 511.63 g/mol. Its IUPAC name is 2-[ethyl(propyl)amino]-N-[2-[3-[(6-ethynylquinazolin-2-yl)amino]-5-(1-methylpyrazol-4-yl)phenoxy]ethyl]acetamide.
| Compound Name | 2-[ethyl(propyl)amino]-N-[2-[3-[(6-ethynylquinazolin-2-yl)amino]-5-(1-methylpyrazol-4-yl)phenoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 143913303 |
| Molecular Formula | C29H33N7O2 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | 2-[ethyl(propyl)amino]-N-[2-[3-[(6-ethynylquinazolin-2-yl)amino]-5-(1-methylpyrazol-4-yl)phenoxy]ethyl]acetamide |
| SMILES | C#Cc1ccc2nc(Nc3cc(OCCNC(=O)CN(CC)CCC)cc(-c4cnn(C)c4)c3)ncc2c1 |
| InChI | InChI=1S/C29H33N7O2/c1-5-11-36(7-3)20-28(37)30-10-12-38-26-15-22(24-18-32-35(4)19-24)14-25(16-26)33-29-31-17-23-13-21(6-2)8-9-27(23)34-29/h2,8-9,13-19H,5,7,10-12,20H2,1,3-4H3,(H,30,37)(H,31,33,34) |
| InChIKey | ZQWANDBVCZADBU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|