C23H20N6O — CID 143712472
6-ethynyl-N-[3-(2-iminopropoxy)-5-(1-methylpyrazol-4-yl)phenyl]quinazolin-2-amine (PubChem CID 143712472) has the molecular formula C23H20N6O and a molecular weight of 396.45 g/mol. Its IUPAC name is 6-ethynyl-N-[3-(2-iminopropoxy)-5-(1-methylpyrazol-4-yl)phenyl]quinazolin-2-amine.
| Compound Name | 6-ethynyl-N-[3-(2-iminopropoxy)-5-(1-methylpyrazol-4-yl)phenyl]quinazolin-2-amine |
|---|---|
| PubChem CID | 143712472 |
| Molecular Formula | C23H20N6O |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 6-ethynyl-N-[3-(2-iminopropoxy)-5-(1-methylpyrazol-4-yl)phenyl]quinazolin-2-amine |
| SMILES | [H]/N=C(\C)COc1cc(Nc2ncc3cc(C#C)ccc3n2)cc(-c2cnn(C)c2)c1 |
| InChI | InChI=1S/C23H20N6O/c1-4-16-5-6-22-18(7-16)11-25-23(28-22)27-20-8-17(19-12-26-29(3)13-19)9-21(10-20)30-14-15(2)24/h1,5-13,24H,14H2,2-3H3,(H,25,27,28)/b24-15+ |
| InChIKey | RTVYCPXJDPLPMR-BUVRLJJBSA-N |
| XLogP | 4.17 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|