C33H41N7O4Si — CID 67081912
tert-butyl N-[(2R)-1-[2-[3-(1-methylpyrazol-4-yl)-5-[[6-(2-trimethylsilylethynyl)quinazolin-2-yl]amino]phenoxy]ethylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 67081912) has the molecular formula C33H41N7O4Si and a molecular weight of 627.82 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[2-[3-(1-methylpyrazol-4-yl)-5-[[6-(2-trimethylsilylethynyl)quinazolin-2-yl]amino]phenoxy]ethylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[2-[3-(1-methylpyrazol-4-yl)-5-[[6-(2-trimethylsilylethynyl)quinazolin-2-yl]amino]phenoxy]ethylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 67081912 |
| Molecular Formula | C33H41N7O4Si |
| Molecular Weight | 627.82 g/mol |
| Exact Mass | 627.30 |
| IUPAC Name | tert-butyl N-[(2R)-1-[2-[3-(1-methylpyrazol-4-yl)-5-[[6-(2-trimethylsilylethynyl)quinazolin-2-yl]amino]phenoxy]ethylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)C(=O)NCCOc1cc(Nc2ncc3cc(C#C[Si](C)(C)C)ccc3n2)cc(-c2cnn(C)c2)c1 |
| InChI | InChI=1S/C33H41N7O4Si/c1-22(37-32(42)44-33(2,3)4)30(41)34-12-13-43-28-17-24(26-20-36-40(5)21-26)16-27(18-28)38-31-35-19-25-15-23(9-10-29(25)39-31)11-14-45(6,7)8/h9-10,15-22H,12-13H2,1-8H3,(H,34,41)(H,37,42)(H,35,38,39)/t22-/m1/s1 |
| InChIKey | OBAXKKMWRZWUGV-JOCHJYFZSA-N |
| XLogP | 5.41 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.82 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|