C22H16N6 — CID 59325656
2-[3-[(6-ethynylquinazolin-2-yl)amino]-5-(1-methylpyrazol-4-yl)phenyl]acetonitrile (PubChem CID 59325656) has the molecular formula C22H16N6 and a molecular weight of 364.41 g/mol. Its IUPAC name is 2-[3-[(6-ethynylquinazolin-2-yl)amino]-5-(1-methylpyrazol-4-yl)phenyl]acetonitrile.
| Compound Name | 2-[3-[(6-ethynylquinazolin-2-yl)amino]-5-(1-methylpyrazol-4-yl)phenyl]acetonitrile |
|---|---|
| PubChem CID | 59325656 |
| Molecular Formula | C22H16N6 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2-[3-[(6-ethynylquinazolin-2-yl)amino]-5-(1-methylpyrazol-4-yl)phenyl]acetonitrile |
| SMILES | C#Cc1ccc2nc(Nc3cc(CC#N)cc(-c4cnn(C)c4)c3)ncc2c1 |
| InChI | InChI=1S/C22H16N6/c1-3-15-4-5-21-18(8-15)12-24-22(27-21)26-20-10-16(6-7-23)9-17(11-20)19-13-25-28(2)14-19/h1,4-5,8-14H,6H2,2H3,(H,24,26,27) |
| InChIKey | JVQZJVDRNJVCRY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|