C26H24N6O — CID 59325506
N-[3-(2-amino-4-pyridinyl)-5-(morpholin-4-ylmethyl)phenyl]-6-ethynylquinazolin-2-amine (PubChem CID 59325506) has the molecular formula C26H24N6O and a molecular weight of 436.52 g/mol. Its IUPAC name is N-[3-(2-amino-4-pyridinyl)-5-(morpholin-4-ylmethyl)phenyl]-6-ethynylquinazolin-2-amine.
| Compound Name | N-[3-(2-amino-4-pyridinyl)-5-(morpholin-4-ylmethyl)phenyl]-6-ethynylquinazolin-2-amine |
|---|---|
| PubChem CID | 59325506 |
| Molecular Formula | C26H24N6O |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | N-[3-(2-amino-4-pyridinyl)-5-(morpholin-4-ylmethyl)phenyl]-6-ethynylquinazolin-2-amine |
| SMILES | C#Cc1ccc2nc(Nc3cc(CN4CCOCC4)cc(-c4ccnc(N)c4)c3)ncc2c1 |
| InChI | InChI=1S/C26H24N6O/c1-2-18-3-4-24-22(11-18)16-29-26(31-24)30-23-13-19(17-32-7-9-33-10-8-32)12-21(14-23)20-5-6-28-25(27)15-20/h1,3-6,11-16H,7-10,17H2,(H2,27,28)(H,29,30,31) |
| InChIKey | JDIIMPMVFWBZLP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|