C26H26N6O — CID 59325665
6-ethynyl-N-[3-[(2-methylmorpholin-4-yl)methyl]-5-(1-methylpyrazol-4-yl)phenyl]quinazolin-2-amine (PubChem CID 59325665) has the molecular formula C26H26N6O and a molecular weight of 438.54 g/mol. Its IUPAC name is 6-ethynyl-N-[3-[(2-methylmorpholin-4-yl)methyl]-5-(1-methylpyrazol-4-yl)phenyl]quinazolin-2-amine.
| Compound Name | 6-ethynyl-N-[3-[(2-methylmorpholin-4-yl)methyl]-5-(1-methylpyrazol-4-yl)phenyl]quinazolin-2-amine |
|---|---|
| PubChem CID | 59325665 |
| Molecular Formula | C26H26N6O |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 6-ethynyl-N-[3-[(2-methylmorpholin-4-yl)methyl]-5-(1-methylpyrazol-4-yl)phenyl]quinazolin-2-amine |
| SMILES | C#Cc1ccc2nc(Nc3cc(CN4CCOC(C)C4)cc(-c4cnn(C)c4)c3)ncc2c1 |
| InChI | InChI=1S/C26H26N6O/c1-4-19-5-6-25-22(9-19)13-27-26(30-25)29-24-11-20(16-32-7-8-33-18(2)15-32)10-21(12-24)23-14-28-31(3)17-23/h1,5-6,9-14,17-18H,7-8,15-16H2,2-3H3,(H,27,29,30) |
| InChIKey | AECJDDZDDVKZFZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|