C25H24N6O2 — CID 59325501
6-ethynyl-8-methoxy-N-[3-(1-methylazetidin-3-yl)oxy-5-(1-methylpyrazol-4-yl)phenyl]quinazolin-2-amine (PubChem CID 59325501) has the molecular formula C25H24N6O2 and a molecular weight of 440.51 g/mol. Its IUPAC name is 6-ethynyl-8-methoxy-N-[3-(1-methylazetidin-3-yl)oxy-5-(1-methylpyrazol-4-yl)phenyl]quinazolin-2-amine.
| Compound Name | 6-ethynyl-8-methoxy-N-[3-(1-methylazetidin-3-yl)oxy-5-(1-methylpyrazol-4-yl)phenyl]quinazolin-2-amine |
|---|---|
| PubChem CID | 59325501 |
| Molecular Formula | C25H24N6O2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 6-ethynyl-8-methoxy-N-[3-(1-methylazetidin-3-yl)oxy-5-(1-methylpyrazol-4-yl)phenyl]quinazolin-2-amine |
| SMILES | C#Cc1cc(OC)c2nc(Nc3cc(OC4CN(C)C4)cc(-c4cnn(C)c4)c3)ncc2c1 |
| InChI | InChI=1S/C25H24N6O2/c1-5-16-6-18-11-26-25(29-24(18)23(7-16)32-4)28-20-8-17(19-12-27-31(3)13-19)9-21(10-20)33-22-14-30(2)15-22/h1,6-13,22H,14-15H2,2-4H3,(H,26,28,29) |
| InChIKey | GRFPZIKHIRIHIV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|