C26H28N4O3S — CID 143915806
tert-butyl 4-(3-naphthalen-1-ylsulfinyl-2H-indazol-5-yl)piperazine-1-carboxylate (PubChem CID 143915806) has the molecular formula C26H28N4O3S and a molecular weight of 476.60 g/mol. Its IUPAC name is tert-butyl 4-(3-naphthalen-1-ylsulfinyl-2H-indazol-5-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-naphthalen-1-ylsulfinyl-2H-indazol-5-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 143915806 |
| Molecular Formula | C26H28N4O3S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | tert-butyl 4-(3-naphthalen-1-ylsulfinyl-2H-indazol-5-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc3n[nH]c(S(=O)c4cccc5ccccc45)c3c2)CC1 |
| InChI | InChI=1S/C26H28N4O3S/c1-26(2,3)33-25(31)30-15-13-29(14-16-30)19-11-12-22-21(17-19)24(28-27-22)34(32)23-10-6-8-18-7-4-5-9-20(18)23/h4-12,17H,13-16H2,1-3H3,(H,27,28) |
| InChIKey | BFAHIZRBEIICJB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |