C26H40FN3O4 — CID 143923687
4-[3-[1-[(E)-N-(3-fluoro-3-methylbut-1-en-2-yl)oxy-C-methylcarbonimidoyl]piperidin-4-yl]propoxy]-N-(3-hydroxypropyl)-2-methylbenzamide (PubChem CID 143923687) has the molecular formula C26H40FN3O4 and a molecular weight of 477.62 g/mol. Its IUPAC name is 4-[3-[1-[(E)-N-(3-fluoro-3-methylbut-1-en-2-yl)oxy-C-methylcarbonimidoyl]piperidin-4-yl]propoxy]-N-(3-hydroxypropyl)-2-methylbenzamide.
| Compound Name | 4-[3-[1-[(E)-N-(3-fluoro-3-methylbut-1-en-2-yl)oxy-C-methylcarbonimidoyl]piperidin-4-yl]propoxy]-N-(3-hydroxypropyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 143923687 |
| Molecular Formula | C26H40FN3O4 |
| Molecular Weight | 477.62 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | 4-[3-[1-[(E)-N-(3-fluoro-3-methylbut-1-en-2-yl)oxy-C-methylcarbonimidoyl]piperidin-4-yl]propoxy]-N-(3-hydroxypropyl)-2-methylbenzamide |
| SMILES | C=C(O/N=C(\C)N1CCC(CCCOc2ccc(C(=O)NCCCO)c(C)c2)CC1)C(C)(C)F |
| InChI | InChI=1S/C26H40FN3O4/c1-19-18-23(9-10-24(19)25(32)28-13-7-16-31)33-17-6-8-22-11-14-30(15-12-22)21(3)29-34-20(2)26(4,5)27/h9-10,18,22,31H,2,6-8,11-17H2,1,3-5H3,(H,28,32)/b29-21+ |
| InChIKey | YXKJUQSCALENAW-XHLNEMQHSA-N |
| XLogP | 4.59 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.62 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|