C28H43N3O3 — CID 143923743
2-methyl-4-[3-[1-[(E)-C-methyl-N-[1-(3-methylcyclobutyl)ethenoxy]carbonimidoyl]piperidin-4-yl]propoxy]-N-propylbenzamide (PubChem CID 143923743) has the molecular formula C28H43N3O3 and a molecular weight of 469.67 g/mol. Its IUPAC name is 2-methyl-4-[3-[1-[(E)-C-methyl-N-[1-(3-methylcyclobutyl)ethenoxy]carbonimidoyl]piperidin-4-yl]propoxy]-N-propylbenzamide.
| Compound Name | 2-methyl-4-[3-[1-[(E)-C-methyl-N-[1-(3-methylcyclobutyl)ethenoxy]carbonimidoyl]piperidin-4-yl]propoxy]-N-propylbenzamide |
|---|---|
| PubChem CID | 143923743 |
| Molecular Formula | C28H43N3O3 |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 469.33 |
| IUPAC Name | 2-methyl-4-[3-[1-[(E)-C-methyl-N-[1-(3-methylcyclobutyl)ethenoxy]carbonimidoyl]piperidin-4-yl]propoxy]-N-propylbenzamide |
| SMILES | C=C(O/N=C(\C)N1CCC(CCCOc2ccc(C(=O)NCCC)c(C)c2)CC1)C1CC(C)C1 |
| InChI | InChI=1S/C28H43N3O3/c1-6-13-29-28(32)27-10-9-26(19-21(27)3)33-16-7-8-24-11-14-31(15-12-24)23(5)30-34-22(4)25-17-20(2)18-25/h9-10,19-20,24-25H,4,6-8,11-18H2,1-3,5H3,(H,29,32)/b30-23+ |
| InChIKey | GXEAYJWSSHPYRY-JJKYIXSRSA-N |
| XLogP | 5.92 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|