C10H17NO — CID 143929064
(3Z)-7-(methylamino)-5-methylideneocta-1,3-dien-2-ol (PubChem CID 143929064) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (3Z)-7-(methylamino)-5-methylideneocta-1,3-dien-2-ol.
| Compound Name | (3Z)-7-(methylamino)-5-methylideneocta-1,3-dien-2-ol |
|---|---|
| PubChem CID | 143929064 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (3Z)-7-(methylamino)-5-methylideneocta-1,3-dien-2-ol |
| SMILES | C=C(O)/C=C\C(=C)CC(C)NC |
| InChI | InChI=1S/C10H17NO/c1-8(5-6-10(3)12)7-9(2)11-4/h5-6,9,11-12H,1,3,7H2,2,4H3/b6-5- |
| InChIKey | MMOWJQPNTUHCBS-WAYWQWQTSA-N |
| XLogP | 2.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|