C18H30N2O — CID 143933029
(2E,4Z)-2-ethenyl-1-[(2R)-2-[[ethyl(propyl)amino]methyl]pyrrolidin-1-yl]hexa-2,4-dien-1-one (PubChem CID 143933029) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is (2E,4Z)-2-ethenyl-1-[(2R)-2-[[ethyl(propyl)amino]methyl]pyrrolidin-1-yl]hexa-2,4-dien-1-one.
| Compound Name | (2E,4Z)-2-ethenyl-1-[(2R)-2-[[ethyl(propyl)amino]methyl]pyrrolidin-1-yl]hexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 143933029 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | (2E,4Z)-2-ethenyl-1-[(2R)-2-[[ethyl(propyl)amino]methyl]pyrrolidin-1-yl]hexa-2,4-dien-1-one |
| SMILES | C=C/C(=C\C=C/C)C(=O)N1CCC[C@@H]1CN(CC)CCC |
| InChI | InChI=1S/C18H30N2O/c1-5-9-11-16(7-3)18(21)20-14-10-12-17(20)15-19(8-4)13-6-2/h5,7,9,11,17H,3,6,8,10,12-15H2,1-2,4H3/b9-5-,16-11+/t17-/m1/s1 |
| InChIKey | JLUWRGONCFJGBS-MVXDLLEYSA-N |
| XLogP | 3.40 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|