C15H21N3O — CID 143937144
ethyl 4-amino-1-benzyl-3,6-dihydro-2H-pyridine-5-carboximidate (PubChem CID 143937144) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is ethyl 4-amino-1-benzyl-3,6-dihydro-2H-pyridine-5-carboximidate.
| Compound Name | ethyl 4-amino-1-benzyl-3,6-dihydro-2H-pyridine-5-carboximidate |
|---|---|
| PubChem CID | 143937144 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | ethyl 4-amino-1-benzyl-3,6-dihydro-2H-pyridine-5-carboximidate |
| SMILES | [H]/N=C(\OCC)C1=C(N)CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C15H21N3O/c1-2-19-15(17)13-11-18(9-8-14(13)16)10-12-6-4-3-5-7-12/h3-7,17H,2,8-11,16H2,1H3/b17-15- |
| InChIKey | ANKBYUNQMFHUFX-ICFOKQHNSA-N |
| XLogP | 2.12 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|