C18H27NO5 — CID 143938658
tert-butyl (2S)-2-(1,3-dihydroxy-1,3-dihydroisoindol-2-yl)-6-hydroxyhexanoate (PubChem CID 143938658) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is tert-butyl (2S)-2-(1,3-dihydroxy-1,3-dihydroisoindol-2-yl)-6-hydroxyhexanoate.
| Compound Name | tert-butyl (2S)-2-(1,3-dihydroxy-1,3-dihydroisoindol-2-yl)-6-hydroxyhexanoate |
|---|---|
| PubChem CID | 143938658 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | tert-butyl (2S)-2-(1,3-dihydroxy-1,3-dihydroisoindol-2-yl)-6-hydroxyhexanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CCCCO)N1C(O)c2ccccc2C1O |
| InChI | InChI=1S/C18H27NO5/c1-18(2,3)24-17(23)14(10-6-7-11-20)19-15(21)12-8-4-5-9-13(12)16(19)22/h4-5,8-9,14-16,20-22H,6-7,10-11H2,1-3H3/t14-,15?,16?/m0/s1 |
| InChIKey | CYIUSMMCVSOBJE-FHERZECASA-N |
| XLogP | 1.86 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|