C9H9ClN2 — CID 143938756
4-[(Z)-2-chloroethenyl]-1,5-bis(ethenyl)pyrazole (PubChem CID 143938756) has the molecular formula C9H9ClN2 and a molecular weight of 180.64 g/mol. Its IUPAC name is 4-[(Z)-2-chloroethenyl]-1,5-bis(ethenyl)pyrazole.
| Compound Name | 4-[(Z)-2-chloroethenyl]-1,5-bis(ethenyl)pyrazole |
|---|---|
| PubChem CID | 143938756 |
| Molecular Formula | C9H9ClN2 |
| Molecular Weight | 180.64 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 4-[(Z)-2-chloroethenyl]-1,5-bis(ethenyl)pyrazole |
| SMILES | C=Cc1c(/C=C\Cl)cnn1C=C |
| InChI | InChI=1S/C9H9ClN2/c1-3-9-8(5-6-10)7-11-12(9)4-2/h3-7H,1-2H2/b6-5- |
| InChIKey | MKCFQRFSNZWRPI-WAYWQWQTSA-N |
| XLogP | 2.84 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.64 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |