C11H14N4O — CID 143942705
N-[2-[(Z)-3-iminobut-1-enyl]-1H-imidazol-5-yl]cyclopropanecarboxamide (PubChem CID 143942705) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is N-[2-[(Z)-3-iminobut-1-enyl]-1H-imidazol-5-yl]cyclopropanecarboxamide.
| Compound Name | N-[2-[(Z)-3-iminobut-1-enyl]-1H-imidazol-5-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 143942705 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | N-[2-[(Z)-3-iminobut-1-enyl]-1H-imidazol-5-yl]cyclopropanecarboxamide |
| SMILES | [H]/N=C(C)/C=C\c1ncc(NC(=O)C2CC2)[nH]1 |
| InChI | InChI=1S/C11H14N4O/c1-7(12)2-5-9-13-6-10(14-9)15-11(16)8-3-4-8/h2,5-6,8,12H,3-4H2,1H3,(H,13,14)(H,15,16)/b5-2-,12-7+ |
| InChIKey | ZHDPWZONFKQLLZ-IHUXOWTPSA-N |
| XLogP | 1.81 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|