C27H32N4O3 — CID 143944559
acetylene;2-[(2R)-6-(3-cyanophenyl)-2-(2,2-dimethyloxan-4-yl)-3,4-dihydro-2H-chromen-4-yl]-1-hydroxy-1-methylguanidine (PubChem CID 143944559) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is acetylene;2-[(2R)-6-(3-cyanophenyl)-2-(2,2-dimethyloxan-4-yl)-3,4-dihydro-2H-chromen-4-yl]-1-hydroxy-1-methylguanidine.
| Compound Name | acetylene;2-[(2R)-6-(3-cyanophenyl)-2-(2,2-dimethyloxan-4-yl)-3,4-dihydro-2H-chromen-4-yl]-1-hydroxy-1-methylguanidine |
|---|---|
| PubChem CID | 143944559 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | acetylene;2-[(2R)-6-(3-cyanophenyl)-2-(2,2-dimethyloxan-4-yl)-3,4-dihydro-2H-chromen-4-yl]-1-hydroxy-1-methylguanidine |
| SMILES | C#C.CN(O)/C(N)=N/C1C[C@H](C2CCOC(C)(C)C2)Oc2ccc(-c3cccc(C#N)c3)cc21 |
| InChI | InChI=1S/C25H30N4O3.C2H2/c1-25(2)14-19(9-10-31-25)23-13-21(28-24(27)29(3)30)20-12-18(7-8-22(20)32-23)17-6-4-5-16(11-17)15-26;1-2/h4-8,11-12,19,21,23,30H,9-10,13-14H2,1-3H3,(H2,27,28);1-2H/t19?,21?,23-;/m1./s1 |
| InChIKey | JRAOMKNCEUBTTJ-PBDPLAMYSA-N |
| XLogP | 4.51 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|