C23H24N4O3 — CID 123649753
2-[8-(3-cyanophenyl)-10-formyl-3,4,4a,10a-tetrahydro-1H-pyrano[4,3-b]chromen-10-yl]-1,1-dimethylguanidine (PubChem CID 123649753) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-[8-(3-cyanophenyl)-10-formyl-3,4,4a,10a-tetrahydro-1H-pyrano[4,3-b]chromen-10-yl]-1,1-dimethylguanidine.
| Compound Name | 2-[8-(3-cyanophenyl)-10-formyl-3,4,4a,10a-tetrahydro-1H-pyrano[4,3-b]chromen-10-yl]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 123649753 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 2-[8-(3-cyanophenyl)-10-formyl-3,4,4a,10a-tetrahydro-1H-pyrano[4,3-b]chromen-10-yl]-1,1-dimethylguanidine |
| SMILES | CN(C)/C(N)=N/C1(C=O)c2cc(-c3cccc(C#N)c3)ccc2OC2CCOCC21 |
| InChI | InChI=1S/C23H24N4O3/c1-27(2)22(25)26-23(14-28)18-11-17(16-5-3-4-15(10-16)12-24)6-7-20(18)30-21-8-9-29-13-19(21)23/h3-7,10-11,14,19,21H,8-9,13H2,1-2H3,(H2,25,26) |
| InChIKey | XYHHMPRXMIIATA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|