C19H21N5OS — CID 145461567
2-[1-[4-(3-cyanophenyl)thiophen-2-yl]-2-methyl-3-oxopropyl]-1,1-dimethylguanidine;formonitrile (PubChem CID 145461567) has the molecular formula C19H21N5OS and a molecular weight of 367.48 g/mol. Its IUPAC name is 2-[1-[4-(3-cyanophenyl)thiophen-2-yl]-2-methyl-3-oxopropyl]-1,1-dimethylguanidine;formonitrile.
| Compound Name | 2-[1-[4-(3-cyanophenyl)thiophen-2-yl]-2-methyl-3-oxopropyl]-1,1-dimethylguanidine;formonitrile |
|---|---|
| PubChem CID | 145461567 |
| Molecular Formula | C19H21N5OS |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-[1-[4-(3-cyanophenyl)thiophen-2-yl]-2-methyl-3-oxopropyl]-1,1-dimethylguanidine;formonitrile |
| SMILES | C#N.CC(C=O)C(/N=C(\N)N(C)C)c1cc(-c2cccc(C#N)c2)cs1 |
| InChI | InChI=1S/C18H20N4OS.CHN/c1-12(10-23)17(21-18(20)22(2)3)16-8-15(11-24-16)14-6-4-5-13(7-14)9-19;1-2/h4-8,10-12,17H,1-3H3,(H2,20,21);1H |
| InChIKey | CSQCSURNLCJAIV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 106.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|