C25H27N5OS — CID 145462326
2-[1-[4-(3-cyanophenyl)thiophen-2-yl]-2-formyl-5-pyridin-3-ylpentyl]-1,1-dimethylguanidine (PubChem CID 145462326) has the molecular formula C25H27N5OS and a molecular weight of 445.59 g/mol. Its IUPAC name is 2-[1-[4-(3-cyanophenyl)thiophen-2-yl]-2-formyl-5-pyridin-3-ylpentyl]-1,1-dimethylguanidine.
| Compound Name | 2-[1-[4-(3-cyanophenyl)thiophen-2-yl]-2-formyl-5-pyridin-3-ylpentyl]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 145462326 |
| Molecular Formula | C25H27N5OS |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 2-[1-[4-(3-cyanophenyl)thiophen-2-yl]-2-formyl-5-pyridin-3-ylpentyl]-1,1-dimethylguanidine |
| SMILES | CN(C)/C(N)=N/C(c1cc(-c2cccc(C#N)c2)cs1)C(C=O)CCCc1cccnc1 |
| InChI | InChI=1S/C25H27N5OS/c1-30(2)25(27)29-24(21(16-31)10-3-6-18-8-5-11-28-15-18)23-13-22(17-32-23)20-9-4-7-19(12-20)14-26/h4-5,7-9,11-13,15-17,21,24H,3,6,10H2,1-2H3,(H2,27,29) |
| InChIKey | UBMXOTWCXZOTGE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 95.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|