C18H20N4OS — CID 145460133
3-(aminomethylideneamino)-3-[4-(3-cyanophenyl)-5-methylthiophen-2-yl]-N,N-dimethylpropanamide (PubChem CID 145460133) has the molecular formula C18H20N4OS and a molecular weight of 340.45 g/mol. Its IUPAC name is 3-(aminomethylideneamino)-3-[4-(3-cyanophenyl)-5-methylthiophen-2-yl]-N,N-dimethylpropanamide.
| Compound Name | 3-(aminomethylideneamino)-3-[4-(3-cyanophenyl)-5-methylthiophen-2-yl]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 145460133 |
| Molecular Formula | C18H20N4OS |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 3-(aminomethylideneamino)-3-[4-(3-cyanophenyl)-5-methylthiophen-2-yl]-N,N-dimethylpropanamide |
| SMILES | Cc1sc(C(CC(=O)N(C)C)/N=C/N)cc1-c1cccc(C#N)c1 |
| InChI | InChI=1S/C18H20N4OS/c1-12-15(14-6-4-5-13(7-14)10-19)8-17(24-12)16(21-11-20)9-18(23)22(2)3/h4-8,11,16H,9H2,1-3H3,(H2,20,21) |
| InChIKey | QSYQVZHNPZKDFE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 82.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|