C13H30IN — CID 143953932
N-(dimethyl-λ3-iodanyl)-2,2,4,4-tetramethylpentan-3-imine;ethane (PubChem CID 143953932) has the molecular formula C13H30IN and a molecular weight of 327.29 g/mol. Its IUPAC name is N-(dimethyl-λ3-iodanyl)-2,2,4,4-tetramethylpentan-3-imine;ethane.
| Compound Name | N-(dimethyl-λ3-iodanyl)-2,2,4,4-tetramethylpentan-3-imine;ethane |
|---|---|
| PubChem CID | 143953932 |
| Molecular Formula | C13H30IN |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | N-(dimethyl-λ3-iodanyl)-2,2,4,4-tetramethylpentan-3-imine;ethane |
| SMILES | CC.CI(C)N=C(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H24IN.C2H6/c1-10(2,3)9(11(4,5)6)13-12(7)8;1-2/h1-8H3;1-2H3 |
| InChIKey | PGBKJCZKFCDMOS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|