C11H24IN — CID 143953933
N-(dimethyl-λ3-iodanyl)-2,2,4,4-tetramethylpentan-3-imine (PubChem CID 143953933) has the molecular formula C11H24IN and a molecular weight of 297.22 g/mol. Its IUPAC name is N-(dimethyl-λ3-iodanyl)-2,2,4,4-tetramethylpentan-3-imine.
| Compound Name | N-(dimethyl-λ3-iodanyl)-2,2,4,4-tetramethylpentan-3-imine |
|---|---|
| PubChem CID | 143953933 |
| Molecular Formula | C11H24IN |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N-(dimethyl-λ3-iodanyl)-2,2,4,4-tetramethylpentan-3-imine |
| SMILES | CI(C)N=C(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H24IN/c1-10(2,3)9(11(4,5)6)13-12(7)8/h1-8H3 |
| InChIKey | DUHMGYVMXLKFRE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|