C9H18I2N- — CID 163772573
N-iodoiodanuidyl-2,2,4,4-tetramethylpentan-3-imine (PubChem CID 163772573) has the molecular formula C9H18I2N- and a molecular weight of 394.06 g/mol. Its IUPAC name is N-iodoiodanuidyl-2,2,4,4-tetramethylpentan-3-imine.
| Compound Name | N-iodoiodanuidyl-2,2,4,4-tetramethylpentan-3-imine |
|---|---|
| PubChem CID | 163772573 |
| Molecular Formula | C9H18I2N- |
| Molecular Weight | 394.06 g/mol |
| Exact Mass | 393.95 |
| IUPAC Name | N-iodoiodanuidyl-2,2,4,4-tetramethylpentan-3-imine |
| SMILES | CC(C)(C)C(=N[I-]I)C(C)(C)C |
| InChI | InChI=1S/C9H18I2N/c1-8(2,3)7(12-11-10)9(4,5)6/h1-6H3/q-1 |
| InChIKey | MUQNMDDSLVBLQP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.06 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|