C19H29OP — CID 143955002
cyclohexyl-[2-[(Z)-1-methoxyprop-1-en-2-yl]phenyl]-propan-2-ylphosphane (PubChem CID 143955002) has the molecular formula C19H29OP and a molecular weight of 304.41 g/mol. Its IUPAC name is cyclohexyl-[2-[(Z)-1-methoxyprop-1-en-2-yl]phenyl]-propan-2-ylphosphane.
| Compound Name | cyclohexyl-[2-[(Z)-1-methoxyprop-1-en-2-yl]phenyl]-propan-2-ylphosphane |
|---|---|
| PubChem CID | 143955002 |
| Molecular Formula | C19H29OP |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | cyclohexyl-[2-[(Z)-1-methoxyprop-1-en-2-yl]phenyl]-propan-2-ylphosphane |
| SMILES | CO/C=C(/C)c1ccccc1P(C(C)C)C1CCCCC1 |
| InChI | InChI=1S/C19H29OP/c1-15(2)21(17-10-6-5-7-11-17)19-13-9-8-12-18(19)16(3)14-20-4/h8-9,12-15,17H,5-7,10-11H2,1-4H3/b16-14- |
| InChIKey | IJWRWBGSZSMKFQ-PEZBUJJGSA-N |
| XLogP | 5.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|