About 2-amino-4-[[6-fluoro-1,6-dimethyl-3-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]pentanedioic acid
2-amino-4-[[6-fluoro-1,6-dimethyl-3-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]pentanedioic acid (PubChem CID 143958499) has the molecular formula C15H21F4NO4
and a molecular weight of 355.33 g/mol. Its IUPAC name is 2-amino-4-[[6-fluoro-1,6-dimethyl-3-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]pentanedioic acid.
Molecular Properties
| Compound Name | 2-amino-4-[[6-fluoro-1,6-dimethyl-3-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]pentanedioic acid |
| PubChem CID | 143958499 |
| Molecular Formula | C15H21F4NO4 |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-amino-4-[[6-fluoro-1,6-dimethyl-3-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]pentanedioic acid |
| SMILES | CC1(F)CC=C(C(F)(F)F)CC1(C)CC(CC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C15H21F4NO4/c1-13(6-8(11(21)22)5-10(20)12(23)24)7-9(15(17,18)19)3-4-14(13,2)16/h3,8,10H,4-7,20H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | IAJIOIPDNPQGCK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-[[6-fluoro-1,6-dimethyl-3-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]pentanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-[[6-fluoro-1,6-dimethyl-3-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]pentanedioic acid?
The IUPAC name of 2-amino-4-[[6-fluoro-1,6-dimethyl-3-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]pentanedioic acid (CID 143958499) is 2-amino-4-[[6-fluoro-1,6-dimethyl-3-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]pentanedioic acid.
What is the SMILES notation for 2-amino-4-[[6-fluoro-1,6-dimethyl-3-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]pentanedioic acid?
The canonical SMILES for 2-amino-4-[[6-fluoro-1,6-dimethyl-3-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]pentanedioic acid is CC1(F)CC=C(C(F)(F)F)CC1(C)CC(CC(N)C(=O)O)C(=O)O.
What is the InChIKey of 2-amino-4-[[6-fluoro-1,6-dimethyl-3-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]pentanedioic acid?
The InChIKey is IAJIOIPDNPQGCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F4NO4/c1-13(6-8(11(21)22)5-10(20)12(23)24)7-9(15(17,18)19)3-4-14(13,2)16/h3,8,10H,4-7,20H2,1-2H3,(H,21,22)(H,23,24).
What are the key properties of 2-amino-4-[[6-fluoro-1,6-dimethyl-3-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]pentanedioic acid?
2-amino-4-[[6-fluoro-1,6-dimethyl-3-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]pentanedioic acid has a molecular weight of 355.33 g/mol, XLogP of 2.90, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-[[6-fluoro-1,6-dimethyl-3-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]pentanedioic acid is sourced from PubChem (CID 143958499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).