C15H21F4NO4 — CID 143958499
2-amino-4-[[6-fluoro-1,6-dimethyl-3-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]pentanedioic acid (PubChem CID 143958499) has the molecular formula C15H21F4NO4 and a molecular weight of 355.33 g/mol. Its IUPAC name is 2-amino-4-[[6-fluoro-1,6-dimethyl-3-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]pentanedioic acid.
| Compound Name | 2-amino-4-[[6-fluoro-1,6-dimethyl-3-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]pentanedioic acid |
|---|---|
| PubChem CID | 143958499 |
| Molecular Formula | C15H21F4NO4 |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-amino-4-[[6-fluoro-1,6-dimethyl-3-(trifluoromethyl)cyclohex-3-en-1-yl]methyl]pentanedioic acid |
| SMILES | CC1(F)CC=C(C(F)(F)F)CC1(C)CC(CC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C15H21F4NO4/c1-13(6-8(11(21)22)5-10(20)12(23)24)7-9(15(17,18)19)3-4-14(13,2)16/h3,8,10H,4-7,20H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | IAJIOIPDNPQGCK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|