C19H25F2N3O4 — CID 143959911
N-[(2R)-3-[4-(5,8-dioxa-10-azadispiro[2.0.44.33]undecan-10-yl)-3,5-difluoroanilino]-2-hydroxypropyl]acetamide (PubChem CID 143959911) has the molecular formula C19H25F2N3O4 and a molecular weight of 397.42 g/mol. Its IUPAC name is N-[(2R)-3-[4-(5,8-dioxa-10-azadispiro[2.0.44.33]undecan-10-yl)-3,5-difluoroanilino]-2-hydroxypropyl]acetamide.
| Compound Name | N-[(2R)-3-[4-(5,8-dioxa-10-azadispiro[2.0.44.33]undecan-10-yl)-3,5-difluoroanilino]-2-hydroxypropyl]acetamide |
|---|---|
| PubChem CID | 143959911 |
| Molecular Formula | C19H25F2N3O4 |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N-[(2R)-3-[4-(5,8-dioxa-10-azadispiro[2.0.44.33]undecan-10-yl)-3,5-difluoroanilino]-2-hydroxypropyl]acetamide |
| SMILES | CC(=O)NC[C@H](O)CNc1cc(F)c(N2CC3(CC3)C3(C2)OCCO3)c(F)c1 |
| InChI | InChI=1S/C19H25F2N3O4/c1-12(25)22-8-14(26)9-23-13-6-15(20)17(16(21)7-13)24-10-18(2-3-18)19(11-24)27-4-5-28-19/h6-7,14,23,26H,2-5,8-11H2,1H3,(H,22,25)/t14-/m0/s1 |
| InChIKey | FAHIARZGATXXAY-AWEZNQCLSA-N |
| XLogP | 1.22 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|