C19H24F2N4O3S — CID 166925359
[1-(cyclobutanecarbonylamino)-3-[3,5-difluoro-4-(2-thia-6-azaspiro[3.3]heptan-6-yl)anilino]propan-2-yl] nitrite (PubChem CID 166925359) has the molecular formula C19H24F2N4O3S and a molecular weight of 426.49 g/mol. Its IUPAC name is [1-(cyclobutanecarbonylamino)-3-[3,5-difluoro-4-(2-thia-6-azaspiro[3.3]heptan-6-yl)anilino]propan-2-yl] nitrite.
| Compound Name | [1-(cyclobutanecarbonylamino)-3-[3,5-difluoro-4-(2-thia-6-azaspiro[3.3]heptan-6-yl)anilino]propan-2-yl] nitrite |
|---|---|
| PubChem CID | 166925359 |
| Molecular Formula | C19H24F2N4O3S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | [1-(cyclobutanecarbonylamino)-3-[3,5-difluoro-4-(2-thia-6-azaspiro[3.3]heptan-6-yl)anilino]propan-2-yl] nitrite |
| SMILES | O=NOC(CNC(=O)C1CCC1)CNc1cc(F)c(N2CC3(CSC3)C2)c(F)c1 |
| InChI | InChI=1S/C19H24F2N4O3S/c20-15-4-13(5-16(21)17(15)25-8-19(9-25)10-29-11-19)22-6-14(28-24-27)7-23-18(26)12-2-1-3-12/h4-5,12,14,22H,1-3,6-11H2,(H,23,26) |
| InChIKey | BVHHYMKTKYNMHD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|