C10H14BrN — CID 143964469
(2E,3Z)-3-(2-bromoethylidene)-2-ethylidene-1,4-dimethylpyrrole (PubChem CID 143964469) has the molecular formula C10H14BrN and a molecular weight of 228.13 g/mol. Its IUPAC name is (2E,3Z)-3-(2-bromoethylidene)-2-ethylidene-1,4-dimethylpyrrole.
| Compound Name | (2E,3Z)-3-(2-bromoethylidene)-2-ethylidene-1,4-dimethylpyrrole |
|---|---|
| PubChem CID | 143964469 |
| Molecular Formula | C10H14BrN |
| Molecular Weight | 228.13 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | (2E,3Z)-3-(2-bromoethylidene)-2-ethylidene-1,4-dimethylpyrrole |
| SMILES | C/C=c1\c(=C/CBr)c(C)cn1C |
| InChI | InChI=1S/C10H14BrN/c1-4-10-9(5-6-11)8(2)7-12(10)3/h4-5,7H,6H2,1-3H3/b9-5-,10-4+ |
| InChIKey | ZEPSHVCOZMUKRH-LPTSPAKCSA-N |
| XLogP | 1.31 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.13 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|