C10H12BrN — CID 90879219
5-bromo-1,3-dimethyl-5,6-dihydroindole (PubChem CID 90879219) has the molecular formula C10H12BrN and a molecular weight of 226.12 g/mol. Its IUPAC name is 5-bromo-1,3-dimethyl-5,6-dihydroindole.
| Compound Name | 5-bromo-1,3-dimethyl-5,6-dihydroindole |
|---|---|
| PubChem CID | 90879219 |
| Molecular Formula | C10H12BrN |
| Molecular Weight | 226.12 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 5-bromo-1,3-dimethyl-5,6-dihydroindole |
| SMILES | Cc1cn(C)c2c1=CC(Br)CC=2 |
| InChI | InChI=1S/C10H12BrN/c1-7-6-12(2)10-4-3-8(11)5-9(7)10/h4-6,8H,3H2,1-2H3 |
| InChIKey | XPHWJRCHMOVXSP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.12 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|