C12H20BrN — CID 143964468
(2E,3Z)-3-(2-bromoethylidene)-2-ethylidene-1,4-dimethylpyrrole;ethane (PubChem CID 143964468) has the molecular formula C12H20BrN and a molecular weight of 258.20 g/mol. Its IUPAC name is (2E,3Z)-3-(2-bromoethylidene)-2-ethylidene-1,4-dimethylpyrrole;ethane.
| Compound Name | (2E,3Z)-3-(2-bromoethylidene)-2-ethylidene-1,4-dimethylpyrrole;ethane |
|---|---|
| PubChem CID | 143964468 |
| Molecular Formula | C12H20BrN |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | (2E,3Z)-3-(2-bromoethylidene)-2-ethylidene-1,4-dimethylpyrrole;ethane |
| SMILES | C/C=c1\c(=C/CBr)c(C)cn1C.CC |
| InChI | InChI=1S/C10H14BrN.C2H6/c1-4-10-9(5-6-11)8(2)7-12(10)3;1-2/h4-5,7H,6H2,1-3H3;1-2H3/b9-5-,10-4+; |
| InChIKey | BYXVCOOIOPRTHG-JXYOLPFWSA-N |
| XLogP | 2.34 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|