C11H19N — CID 90918921
N,N-dimethyl-4-prop-1-en-2-ylhexa-2,4-dien-3-amine (PubChem CID 90918921) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is N,N-dimethyl-4-prop-1-en-2-ylhexa-2,4-dien-3-amine.
| Compound Name | N,N-dimethyl-4-prop-1-en-2-ylhexa-2,4-dien-3-amine |
|---|---|
| PubChem CID | 90918921 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | N,N-dimethyl-4-prop-1-en-2-ylhexa-2,4-dien-3-amine |
| SMILES | C=C(C)C(=CC)C(=CC)N(C)C |
| InChI | InChI=1S/C11H19N/c1-7-10(9(3)4)11(8-2)12(5)6/h7-8H,3H2,1-2,4-6H3 |
| InChIKey | CNWQISBKEDOXIU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|