About 1-ethenyl-4-ethylidene-2,3-dimethylidenepyridine
1-ethenyl-4-ethylidene-2,3-dimethylidenepyridine (PubChem CID 91319769) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is 1-ethenyl-4-ethylidene-2,3-dimethylidenepyridine.
Molecular Properties
| Compound Name | 1-ethenyl-4-ethylidene-2,3-dimethylidenepyridine |
| PubChem CID | 91319769 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 1-ethenyl-4-ethylidene-2,3-dimethylidenepyridine |
| SMILES | C=CN1C=CC(=CC)C(=C)C1=C |
| InChI | InChI=1S/C11H13N/c1-5-11-7-8-12(6-2)10(4)9(11)3/h5-8H,2-4H2,1H3 |
| InChIKey | NVYSRECRRJTMPO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethenyl-4-ethylidene-2,3-dimethylidenepyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-4-ethylidene-2,3-dimethylidenepyridine?
The IUPAC name of 1-ethenyl-4-ethylidene-2,3-dimethylidenepyridine (CID 91319769) is 1-ethenyl-4-ethylidene-2,3-dimethylidenepyridine.
What is the SMILES notation for 1-ethenyl-4-ethylidene-2,3-dimethylidenepyridine?
The canonical SMILES for 1-ethenyl-4-ethylidene-2,3-dimethylidenepyridine is C=CN1C=CC(=CC)C(=C)C1=C.
What is the InChIKey of 1-ethenyl-4-ethylidene-2,3-dimethylidenepyridine?
The InChIKey is NVYSRECRRJTMPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N/c1-5-11-7-8-12(6-2)10(4)9(11)3/h5-8H,2-4H2,1H3.
What are the key properties of 1-ethenyl-4-ethylidene-2,3-dimethylidenepyridine?
1-ethenyl-4-ethylidene-2,3-dimethylidenepyridine has a molecular weight of 159.23 g/mol, XLogP of 2.98, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-4-ethylidene-2,3-dimethylidenepyridine is sourced from PubChem (CID 91319769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).