About methanol;1-methoxypyridin-1-ium-3-carbaldehyde
methanol;1-methoxypyridin-1-ium-3-carbaldehyde (PubChem CID 143966737) has the molecular formula C8H12NO3+
and a molecular weight of 170.19 g/mol. Its IUPAC name is methanol;1-methoxypyridin-1-ium-3-carbaldehyde.
Molecular Properties
| Compound Name | methanol;1-methoxypyridin-1-ium-3-carbaldehyde |
| PubChem CID | 143966737 |
| Molecular Formula | C8H12NO3+ |
| Molecular Weight | 170.19 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | methanol;1-methoxypyridin-1-ium-3-carbaldehyde |
| SMILES | CO.CO[n+]1cccc(C=O)c1 |
| InChI | InChI=1S/C7H8NO2.CH4O/c1-10-8-4-2-3-7(5-8)6-9;1-2/h2-6H,1H3;2H,1H3/q+1; |
| InChIKey | MPLZWMDDPBWGPP-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.19 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methanol;1-methoxypyridin-1-ium-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;1-methoxypyridin-1-ium-3-carbaldehyde?
The IUPAC name of methanol;1-methoxypyridin-1-ium-3-carbaldehyde (CID 143966737) is methanol;1-methoxypyridin-1-ium-3-carbaldehyde.
What is the SMILES notation for methanol;1-methoxypyridin-1-ium-3-carbaldehyde?
The canonical SMILES for methanol;1-methoxypyridin-1-ium-3-carbaldehyde is CO.CO[n+]1cccc(C=O)c1.
What is the InChIKey of methanol;1-methoxypyridin-1-ium-3-carbaldehyde?
The InChIKey is MPLZWMDDPBWGPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8NO2.CH4O/c1-10-8-4-2-3-7(5-8)6-9;1-2/h2-6H,1H3;2H,1H3/q+1;.
What are the key properties of methanol;1-methoxypyridin-1-ium-3-carbaldehyde?
methanol;1-methoxypyridin-1-ium-3-carbaldehyde has a molecular weight of 170.19 g/mol, XLogP of -0.55, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;1-methoxypyridin-1-ium-3-carbaldehyde is sourced from PubChem (CID 143966737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).