C29H29N5 — CID 143967802
3-[8-[[1-[3-(dimethylamino)phenyl]piperidin-4-yl]amino]isoquinolin-6-yl]benzonitrile (PubChem CID 143967802) has the molecular formula C29H29N5 and a molecular weight of 447.59 g/mol. Its IUPAC name is 3-[8-[[1-[3-(dimethylamino)phenyl]piperidin-4-yl]amino]isoquinolin-6-yl]benzonitrile.
| Compound Name | 3-[8-[[1-[3-(dimethylamino)phenyl]piperidin-4-yl]amino]isoquinolin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 143967802 |
| Molecular Formula | C29H29N5 |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 3-[8-[[1-[3-(dimethylamino)phenyl]piperidin-4-yl]amino]isoquinolin-6-yl]benzonitrile |
| SMILES | CN(C)c1cccc(N2CCC(Nc3cc(-c4cccc(C#N)c4)cc4ccncc34)CC2)c1 |
| InChI | InChI=1S/C29H29N5/c1-33(2)26-7-4-8-27(18-26)34-13-10-25(11-14-34)32-29-17-24(16-23-9-12-31-20-28(23)29)22-6-3-5-21(15-22)19-30/h3-9,12,15-18,20,25,32H,10-11,13-14H2,1-2H3 |
| InChIKey | JWYLTLAMFJTRBC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 55.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |