C42H43N3O5 — CID 143968225
3-[1-benzyl-1-butyl-2-[(1E,3Z,5Z)-5-[3-(2-carboxyethyl)-6,7-dihydro-1,3-benzoxazol-2-ylidene]-3-cyanopenta-1,3-dienyl]-2H-benzo[e]indol-3-yl]propanoic acid (PubChem CID 143968225) has the molecular formula C42H43N3O5 and a molecular weight of 669.82 g/mol. Its IUPAC name is 3-[1-benzyl-1-butyl-2-[(1E,3Z,5Z)-5-[3-(2-carboxyethyl)-6,7-dihydro-1,3-benzoxazol-2-ylidene]-3-cyanopenta-1,3-dienyl]-2H-benzo[e]indol-3-yl]propanoic acid.
| Compound Name | 3-[1-benzyl-1-butyl-2-[(1E,3Z,5Z)-5-[3-(2-carboxyethyl)-6,7-dihydro-1,3-benzoxazol-2-ylidene]-3-cyanopenta-1,3-dienyl]-2H-benzo[e]indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 143968225 |
| Molecular Formula | C42H43N3O5 |
| Molecular Weight | 669.82 g/mol |
| Exact Mass | 669.32 |
| IUPAC Name | 3-[1-benzyl-1-butyl-2-[(1E,3Z,5Z)-5-[3-(2-carboxyethyl)-6,7-dihydro-1,3-benzoxazol-2-ylidene]-3-cyanopenta-1,3-dienyl]-2H-benzo[e]indol-3-yl]propanoic acid |
| SMILES | CCCCC1(Cc2ccccc2)c2c(ccc3ccccc23)N(CCC(=O)O)C1/C=C/C(C#N)=C/C=C1\OC2=C(C=CCC2)N1CCC(=O)O |
| InChI | InChI=1S/C42H43N3O5/c1-2-3-25-42(28-30-11-5-4-6-12-30)37(44(26-23-39(46)47)35-20-19-32-13-7-8-14-33(32)41(35)42)21-17-31(29-43)18-22-38-45(27-24-40(48)49)34-15-9-10-16-36(34)50-38/h4-9,11-15,17-22,37H,2-3,10,16,23-28H2,1H3,(H,46,47)(H,48,49)/b21-17+,31-18-,38-22- |
| InChIKey | UOGKWJJNDYJGMV-XIYPQITFSA-N |
| XLogP | 8.39 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.82 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|