C39H40N2O2 — CID 122451552
3-[1,1-dimethyl-2-[(1E,3E,5E,7E)-7-(3-propyl-1H-benzo[e]indol-2-ylidene)hepta-1,3,5-trienyl]-2H-benzo[e]indol-3-yl]propanoic acid (PubChem CID 122451552) has the molecular formula C39H40N2O2 and a molecular weight of 568.76 g/mol. Its IUPAC name is 3-[1,1-dimethyl-2-[(1E,3E,5E,7E)-7-(3-propyl-1H-benzo[e]indol-2-ylidene)hepta-1,3,5-trienyl]-2H-benzo[e]indol-3-yl]propanoic acid.
| Compound Name | 3-[1,1-dimethyl-2-[(1E,3E,5E,7E)-7-(3-propyl-1H-benzo[e]indol-2-ylidene)hepta-1,3,5-trienyl]-2H-benzo[e]indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 122451552 |
| Molecular Formula | C39H40N2O2 |
| Molecular Weight | 568.76 g/mol |
| Exact Mass | 568.31 |
| IUPAC Name | 3-[1,1-dimethyl-2-[(1E,3E,5E,7E)-7-(3-propyl-1H-benzo[e]indol-2-ylidene)hepta-1,3,5-trienyl]-2H-benzo[e]indol-3-yl]propanoic acid |
| SMILES | CCCN1/C(=C/C=C/C=C/C=C/C2N(CCC(=O)O)c3ccc4ccccc4c3C2(C)C)Cc2c1ccc1ccccc21 |
| InChI | InChI=1S/C39H40N2O2/c1-4-25-40-30(27-33-31-17-12-10-14-28(31)20-22-34(33)40)16-8-6-5-7-9-19-36-39(2,3)38-32-18-13-11-15-29(32)21-23-35(38)41(36)26-24-37(42)43/h5-23,36H,4,24-27H2,1-3H3,(H,42,43)/b7-5+,8-6+,19-9+,30-16+ |
| InChIKey | QKOUJSJNBZHECO-KQYKZEAWSA-N |
| XLogP | 8.96 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.76 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|