C42H46N3O4S+ — CID 158554080
3-[2-[5-[3-(2-carboxyethyl)benzo[g][1,3]benzothiazol-3-ium-2-yl]-3-cyanopenta-2,4-dienylidene]-5-ethyl-3-hexyl-3-prop-2-enylindol-1-yl]propanoic acid (PubChem CID 158554080) has the molecular formula C42H46N3O4S+ and a molecular weight of 688.91 g/mol. Its IUPAC name is 3-[2-[5-[3-(2-carboxyethyl)benzo[g][1,3]benzothiazol-3-ium-2-yl]-3-cyanopenta-2,4-dienylidene]-5-ethyl-3-hexyl-3-prop-2-enylindol-1-yl]propanoic acid.
| Compound Name | 3-[2-[5-[3-(2-carboxyethyl)benzo[g][1,3]benzothiazol-3-ium-2-yl]-3-cyanopenta-2,4-dienylidene]-5-ethyl-3-hexyl-3-prop-2-enylindol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 158554080 |
| Molecular Formula | C42H46N3O4S+ |
| Molecular Weight | 688.91 g/mol |
| Exact Mass | 688.32 |
| IUPAC Name | 3-[2-[5-[3-(2-carboxyethyl)benzo[g][1,3]benzothiazol-3-ium-2-yl]-3-cyanopenta-2,4-dienylidene]-5-ethyl-3-hexyl-3-prop-2-enylindol-1-yl]propanoic acid |
| SMILES | C=CCC1(CCCCCC)C(=CC=C(C#N)C=Cc2sc3c4ccccc4ccc3[n+]2CCC(=O)O)N(CCC(=O)O)c2ccc(CC)cc21 |
| InChI | InChI=1S/C42H45N3O4S/c1-4-7-8-11-25-42(24-5-2)34-28-30(6-3)14-18-35(34)44(26-22-39(46)47)37(42)20-15-31(29-43)16-21-38-45(27-23-40(48)49)36-19-17-32-12-9-10-13-33(32)41(36)50-38/h5,9-10,12-21,28H,2,4,6-8,11,22-27H2,1,3H3,(H-,46,47,48,49)/p+1 |
| InChIKey | YTMMOTPOLKRTIE-UHFFFAOYSA-O |
| XLogP | 9.51 |
| TPSA | 105.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.91 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|