C49H43BrClFN3O3+ — CID 76760344
3-[3-[(4-bromo-2-fluorophenyl)methyl]-2-[3-cyano-5-[3,3-dibenzyl-5-chloro-1-(2-hydroxyethyl)indol-2-ylidene]penta-1,3-dienyl]-3-methylindol-1-ium-1-yl]propanoic acid (PubChem CID 76760344) has the molecular formula C49H43BrClFN3O3+ and a molecular weight of 856.26 g/mol. Its IUPAC name is 3-[3-[(4-bromo-2-fluorophenyl)methyl]-2-[3-cyano-5-[3,3-dibenzyl-5-chloro-1-(2-hydroxyethyl)indol-2-ylidene]penta-1,3-dienyl]-3-methylindol-1-ium-1-yl]propanoic acid.
| Compound Name | 3-[3-[(4-bromo-2-fluorophenyl)methyl]-2-[3-cyano-5-[3,3-dibenzyl-5-chloro-1-(2-hydroxyethyl)indol-2-ylidene]penta-1,3-dienyl]-3-methylindol-1-ium-1-yl]propanoic acid |
|---|---|
| PubChem CID | 76760344 |
| Molecular Formula | C49H43BrClFN3O3+ |
| Molecular Weight | 856.26 g/mol |
| Exact Mass | 854.22 |
| IUPAC Name | 3-[3-[(4-bromo-2-fluorophenyl)methyl]-2-[3-cyano-5-[3,3-dibenzyl-5-chloro-1-(2-hydroxyethyl)indol-2-ylidene]penta-1,3-dienyl]-3-methylindol-1-ium-1-yl]propanoic acid |
| SMILES | CC1(Cc2ccc(Br)cc2F)C(C=CC(C#N)=CC=C2N(CCO)c3ccc(Cl)cc3C2(Cc2ccccc2)Cc2ccccc2)=[N+](CCC(=O)O)c2ccccc21 |
| InChI | InChI=1S/C49H42BrClFN3O3/c1-48(32-37-18-19-38(50)28-42(37)52)40-14-8-9-15-43(40)54(25-24-47(57)58)45(48)22-16-36(33-53)17-23-46-49(30-34-10-4-2-5-11-34,31-35-12-6-3-7-13-35)41-29-39(51)20-21-44(41)55(46)26-27-56/h2-23,28-29,56H,24-27,30-32H2,1H3/p+1 |
| InChIKey | DGQBNOZTOZGAFS-UHFFFAOYSA-O |
| XLogP | 10.44 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.26 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|