C45H45N4O4+ — CID 76760356
3-[3-benzyl-2-[3-cyano-5-[1-ethyl-3-(2-formyloxyethyl)benzimidazol-3-ium-2-yl]penta-2,4-dienylidene]-5-methyl-3-[(2-methylphenyl)methyl]indol-1-yl]propanoic acid (PubChem CID 76760356) has the molecular formula C45H45N4O4+ and a molecular weight of 705.88 g/mol. Its IUPAC name is 3-[3-benzyl-2-[3-cyano-5-[1-ethyl-3-(2-formyloxyethyl)benzimidazol-3-ium-2-yl]penta-2,4-dienylidene]-5-methyl-3-[(2-methylphenyl)methyl]indol-1-yl]propanoic acid.
| Compound Name | 3-[3-benzyl-2-[3-cyano-5-[1-ethyl-3-(2-formyloxyethyl)benzimidazol-3-ium-2-yl]penta-2,4-dienylidene]-5-methyl-3-[(2-methylphenyl)methyl]indol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 76760356 |
| Molecular Formula | C45H45N4O4+ |
| Molecular Weight | 705.88 g/mol |
| Exact Mass | 705.34 |
| IUPAC Name | 3-[3-benzyl-2-[3-cyano-5-[1-ethyl-3-(2-formyloxyethyl)benzimidazol-3-ium-2-yl]penta-2,4-dienylidene]-5-methyl-3-[(2-methylphenyl)methyl]indol-1-yl]propanoic acid |
| SMILES | CCn1c(C=CC(C#N)=CC=C2N(CCC(=O)O)c3ccc(C)cc3C2(Cc2ccccc2)Cc2ccccc2C)[n+](CCOC=O)c2ccccc21 |
| InChI | InChI=1S/C45H44N4O4/c1-4-47-40-16-10-11-17-41(40)49(26-27-53-32-50)43(47)23-20-36(31-46)19-22-42-45(29-35-13-6-5-7-14-35,30-37-15-9-8-12-34(37)3)38-28-33(2)18-21-39(38)48(42)25-24-44(51)52/h5-23,28,32H,4,24-27,29-30H2,1-3H3/p+1 |
| InChIKey | LZDPQYXVNZHJGW-UHFFFAOYSA-O |
| XLogP | 7.80 |
| TPSA | 99.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.88 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|