C45H63N3O3 — CID 143968327
3-[2-[(8E,10Z,12E)-12-[3-butyl-5-ethyl-1-(3-oxopropyl)-3-propylindol-2-ylidene]-10-cyano-6-ethyldodeca-8,10-dien-6-yl]-4-methylanilino]propanoic acid (PubChem CID 143968327) has the molecular formula C45H63N3O3 and a molecular weight of 694.02 g/mol. Its IUPAC name is 3-[2-[(8E,10Z,12E)-12-[3-butyl-5-ethyl-1-(3-oxopropyl)-3-propylindol-2-ylidene]-10-cyano-6-ethyldodeca-8,10-dien-6-yl]-4-methylanilino]propanoic acid.
| Compound Name | 3-[2-[(8E,10Z,12E)-12-[3-butyl-5-ethyl-1-(3-oxopropyl)-3-propylindol-2-ylidene]-10-cyano-6-ethyldodeca-8,10-dien-6-yl]-4-methylanilino]propanoic acid |
|---|---|
| PubChem CID | 143968327 |
| Molecular Formula | C45H63N3O3 |
| Molecular Weight | 694.02 g/mol |
| Exact Mass | 693.49 |
| IUPAC Name | 3-[2-[(8E,10Z,12E)-12-[3-butyl-5-ethyl-1-(3-oxopropyl)-3-propylindol-2-ylidene]-10-cyano-6-ethyldodeca-8,10-dien-6-yl]-4-methylanilino]propanoic acid |
| SMILES | CCCCCC(CC)(C/C=C/C(C#N)=C/C=C1/N(CCC=O)c2ccc(CC)cc2C1(CCC)CCCC)c1cc(C)ccc1NCCC(=O)O |
| InChI | InChI=1S/C45H63N3O3/c1-7-12-14-26-44(11-5,38-32-35(6)18-21-40(38)47-29-24-43(50)51)27-15-17-37(34-46)20-23-42-45(25-9-3,28-13-8-2)39-33-36(10-4)19-22-41(39)48(42)30-16-31-49/h15,17-23,31-33,47H,7-14,16,24-30H2,1-6H3,(H,50,51)/b17-15+,37-20-,42-23+ |
| InChIKey | HHMHUONVZJNZOD-ZVGLDECASA-N |
| XLogP | 11.29 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.02 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|