C39H45N3O2 — CID 143968274
3-[(2E)-2-[(2Z,4E)-3-cyano-7-methyl-7-[5-methyl-2-(propylamino)phenyl]octa-2,4-dienylidene]-3,3-dimethyl-5-phenylindol-1-yl]propanoic acid (PubChem CID 143968274) has the molecular formula C39H45N3O2 and a molecular weight of 587.81 g/mol. Its IUPAC name is 3-[(2E)-2-[(2Z,4E)-3-cyano-7-methyl-7-[5-methyl-2-(propylamino)phenyl]octa-2,4-dienylidene]-3,3-dimethyl-5-phenylindol-1-yl]propanoic acid.
| Compound Name | 3-[(2E)-2-[(2Z,4E)-3-cyano-7-methyl-7-[5-methyl-2-(propylamino)phenyl]octa-2,4-dienylidene]-3,3-dimethyl-5-phenylindol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 143968274 |
| Molecular Formula | C39H45N3O2 |
| Molecular Weight | 587.81 g/mol |
| Exact Mass | 587.35 |
| IUPAC Name | 3-[(2E)-2-[(2Z,4E)-3-cyano-7-methyl-7-[5-methyl-2-(propylamino)phenyl]octa-2,4-dienylidene]-3,3-dimethyl-5-phenylindol-1-yl]propanoic acid |
| SMILES | CCCNc1ccc(C)cc1C(C)(C)C/C=C/C(C#N)=C/C=C1/N(CCC(=O)O)c2ccc(-c3ccccc3)cc2C1(C)C |
| InChI | InChI=1S/C39H45N3O2/c1-7-23-41-34-18-15-28(2)25-32(34)38(3,4)22-11-12-29(27-40)16-20-36-39(5,6)33-26-31(30-13-9-8-10-14-30)17-19-35(33)42(36)24-21-37(43)44/h8-20,25-26,41H,7,21-24H2,1-6H3,(H,43,44)/b12-11+,29-16-,36-20+ |
| InChIKey | AKWCVEAMSXTLLE-KDVBYQFPSA-N |
| XLogP | 9.31 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.81 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|