C33H42N4O5 — CID 143968215
3-[2-[(4E,6Z,8E)-6-cyano-8-(5-methoxy-3,3-dimethyl-1-propyl-6,7-dihydroindol-2-ylidene)-2-methylocta-4,6-dien-2-yl]-4-nitroanilino]propanoic acid (PubChem CID 143968215) has the molecular formula C33H42N4O5 and a molecular weight of 574.72 g/mol. Its IUPAC name is 3-[2-[(4E,6Z,8E)-6-cyano-8-(5-methoxy-3,3-dimethyl-1-propyl-6,7-dihydroindol-2-ylidene)-2-methylocta-4,6-dien-2-yl]-4-nitroanilino]propanoic acid.
| Compound Name | 3-[2-[(4E,6Z,8E)-6-cyano-8-(5-methoxy-3,3-dimethyl-1-propyl-6,7-dihydroindol-2-ylidene)-2-methylocta-4,6-dien-2-yl]-4-nitroanilino]propanoic acid |
|---|---|
| PubChem CID | 143968215 |
| Molecular Formula | C33H42N4O5 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.32 |
| IUPAC Name | 3-[2-[(4E,6Z,8E)-6-cyano-8-(5-methoxy-3,3-dimethyl-1-propyl-6,7-dihydroindol-2-ylidene)-2-methylocta-4,6-dien-2-yl]-4-nitroanilino]propanoic acid |
| SMILES | CCCN1C2=C(C=C(OC)CC2)C(C)(C)/C1=C\C=C(C#N)\C=C\CC(C)(C)c1cc([N+](=O)[O-])ccc1NCCC(=O)O |
| InChI | InChI=1S/C33H42N4O5/c1-7-19-36-29-14-12-25(42-6)21-27(29)33(4,5)30(36)15-10-23(22-34)9-8-17-32(2,3)26-20-24(37(40)41)11-13-28(26)35-18-16-31(38)39/h8-11,13,15,20-21,35H,7,12,14,16-19H2,1-6H3,(H,38,39)/b9-8+,23-10-,30-15+ |
| InChIKey | XEQWHNYBNQEXRI-BXYNKYOKSA-N |
| XLogP | 7.37 |
| TPSA | 128.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|